5-bromo-7-methoxy-1-benzofuran-2-carboxylic acid
Catalog No: FT-0759504
CAS No: 20037-37-0
- Chemical Name: 5-bromo-7-methoxy-1-benzofuran-2-carboxylic acid
- Molecular Formula: C10H7BrO4
- Molecular Weight: 271.06
- InChI Key: OEICZFFUNDGUEF-UHFFFAOYSA-N
- InChI: InChI=1S/C10H7BrO4/c1-14-7-4-6(11)2-5-3-8(10(12)13)15-9(5)7/h2-4H,1H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 20037-37-0 |
|---|---|
| MF: | C10H7BrO4 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 5-Bromo-7-methoxy-1-benzofuran-2-carboxylic acid |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 271.06400 |
| Exact_Mass: | 269.95300 |
|---|---|
| MF: | C10H7BrO4 |
| LogP: | 2.90210 |
| PSA: | 59.67000 |
| FW: | 271.06400 |
| Safety_Statements: | H315-H319-H335 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2932999099 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)